C17H29ClN2 — CID 114848078
2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-pentylaniline (PubChem CID 114848078) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-pentylaniline.
| Compound Name | 2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-pentylaniline |
|---|---|
| PubChem CID | 114848078 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-pentylaniline |
| SMILES | CCCCCN(C)c1cc(Cl)ccc1CNC(C)(C)C |
| InChI | InChI=1S/C17H29ClN2/c1-6-7-8-11-20(5)16-12-15(18)10-9-14(16)13-19-17(2,3)4/h9-10,12,19H,6-8,11,13H2,1-5H3 |
| InChIKey | IUGUNEHVUHIHTK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|