C17H29ClN2 — CID 114848900
2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-(3-methylbutyl)aniline (PubChem CID 114848900) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-(3-methylbutyl)aniline.
| Compound Name | 2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-(3-methylbutyl)aniline |
|---|---|
| PubChem CID | 114848900 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-5-chloro-N-methyl-N-(3-methylbutyl)aniline |
| SMILES | CC(C)CCN(C)c1cc(Cl)ccc1CNC(C)(C)C |
| InChI | InChI=1S/C17H29ClN2/c1-13(2)9-10-20(6)16-11-15(18)8-7-14(16)12-19-17(3,4)5/h7-8,11,13,19H,9-10,12H2,1-6H3 |
| InChIKey | PEUKLQJXLRZSPV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |