C15H24ClN3O — CID 114848185
2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]-N,N-dimethylacetamide (PubChem CID 114848185) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]-N,N-dimethylacetamide.
| Compound Name | 2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 114848185 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]-N,N-dimethylacetamide |
| SMILES | CCCNCc1cc(Cl)ccc1N(C)CC(=O)N(C)C |
| InChI | InChI=1S/C15H24ClN3O/c1-5-8-17-10-12-9-13(16)6-7-14(12)19(4)11-15(20)18(2)3/h6-7,9,17H,5,8,10-11H2,1-4H3 |
| InChIKey | DOECCBDYVMCUGW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|