C10H11BrClF2N — CID 107085166
2-(bromomethyl)-4-chloro-N-(2,2-difluoroethyl)-N-methylaniline (PubChem CID 107085166) has the molecular formula C10H11BrClF2N and a molecular weight of 298.56 g/mol. Its IUPAC name is 2-(bromomethyl)-4-chloro-N-(2,2-difluoroethyl)-N-methylaniline.
| Compound Name | 2-(bromomethyl)-4-chloro-N-(2,2-difluoroethyl)-N-methylaniline |
|---|---|
| PubChem CID | 107085166 |
| Molecular Formula | C10H11BrClF2N |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 2-(bromomethyl)-4-chloro-N-(2,2-difluoroethyl)-N-methylaniline |
| SMILES | CN(CC(F)F)c1ccc(Cl)cc1CBr |
| InChI | InChI=1S/C10H11BrClF2N/c1-15(6-10(13)14)9-3-2-8(12)4-7(9)5-11/h2-4,10H,5-6H2,1H3 |
| InChIKey | LTWUECVRYXDJCD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|