C14H22BrClN2 — CID 107082448
N'-[2-(bromomethyl)-4-chlorophenyl]-N,N-dimethyl-N'-propylethane-1,2-diamine (PubChem CID 107082448) has the molecular formula C14H22BrClN2 and a molecular weight of 333.70 g/mol. Its IUPAC name is N'-[2-(bromomethyl)-4-chlorophenyl]-N,N-dimethyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-[2-(bromomethyl)-4-chlorophenyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 107082448 |
| Molecular Formula | C14H22BrClN2 |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N'-[2-(bromomethyl)-4-chlorophenyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN(C)C)c1ccc(Cl)cc1CBr |
| InChI | InChI=1S/C14H22BrClN2/c1-4-7-18(9-8-17(2)3)14-6-5-13(16)10-12(14)11-15/h5-6,10H,4,7-9,11H2,1-3H3 |
| InChIKey | GHTCINNSGMJHFK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|