C15H25ClN2 — CID 114847374
4-chloro-2-(ethylaminomethyl)-N,N-dipropylaniline (PubChem CID 114847374) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is 4-chloro-2-(ethylaminomethyl)-N,N-dipropylaniline.
| Compound Name | 4-chloro-2-(ethylaminomethyl)-N,N-dipropylaniline |
|---|---|
| PubChem CID | 114847374 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-chloro-2-(ethylaminomethyl)-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(Cl)cc1CNCC |
| InChI | InChI=1S/C15H25ClN2/c1-4-9-18(10-5-2)15-8-7-14(16)11-13(15)12-17-6-3/h7-8,11,17H,4-6,9-10,12H2,1-3H3 |
| InChIKey | YRWUYKSTUNCIEU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |