C14H23ClN2 — CID 114847371
5-chloro-2-(methylaminomethyl)-N,N-dipropylaniline (PubChem CID 114847371) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is 5-chloro-2-(methylaminomethyl)-N,N-dipropylaniline.
| Compound Name | 5-chloro-2-(methylaminomethyl)-N,N-dipropylaniline |
|---|---|
| PubChem CID | 114847371 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-chloro-2-(methylaminomethyl)-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1cc(Cl)ccc1CNC |
| InChI | InChI=1S/C14H23ClN2/c1-4-8-17(9-5-2)14-10-13(15)7-6-12(14)11-16-3/h6-7,10,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | ZXWCCGOYUWFMJR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |