C16H27ClN2 — CID 114847834
N,N-dibutyl-5-chloro-2-(methylaminomethyl)aniline (PubChem CID 114847834) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is N,N-dibutyl-5-chloro-2-(methylaminomethyl)aniline.
| Compound Name | N,N-dibutyl-5-chloro-2-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 114847834 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N,N-dibutyl-5-chloro-2-(methylaminomethyl)aniline |
| SMILES | CCCCN(CCCC)c1cc(Cl)ccc1CNC |
| InChI | InChI=1S/C16H27ClN2/c1-4-6-10-19(11-7-5-2)16-12-15(17)9-8-14(16)13-18-3/h8-9,12,18H,4-7,10-11,13H2,1-3H3 |
| InChIKey | AXXPELIEWDEPJJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |