C11H17ClN2 — CID 114847884
5-chloro-N-ethyl-N-methyl-2-(methylaminomethyl)aniline (PubChem CID 114847884) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-methyl-2-(methylaminomethyl)aniline.
| Compound Name | 5-chloro-N-ethyl-N-methyl-2-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 114847884 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-chloro-N-ethyl-N-methyl-2-(methylaminomethyl)aniline |
| SMILES | CCN(C)c1cc(Cl)ccc1CNC |
| InChI | InChI=1S/C11H17ClN2/c1-4-14(3)11-7-10(12)6-5-9(11)8-13-2/h5-7,13H,4,8H2,1-3H3 |
| InChIKey | QZYVTKFDHVDOHC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |