C12H19ClN2 — CID 115468453
2-N-butyl-4-chloro-2-N-ethylbenzene-1,2-diamine (PubChem CID 115468453) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 2-N-butyl-4-chloro-2-N-ethylbenzene-1,2-diamine.
| Compound Name | 2-N-butyl-4-chloro-2-N-ethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115468453 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-N-butyl-4-chloro-2-N-ethylbenzene-1,2-diamine |
| SMILES | CCCCN(CC)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C12H19ClN2/c1-3-5-8-15(4-2)12-9-10(13)6-7-11(12)14/h6-7,9H,3-5,8,14H2,1-2H3 |
| InChIKey | INWPPXCYHQDQRR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|