C14H23ClN2 — CID 115468800
4-chloro-2-N-pentyl-2-N-propan-2-ylbenzene-1,2-diamine (PubChem CID 115468800) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is 4-chloro-2-N-pentyl-2-N-propan-2-ylbenzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-pentyl-2-N-propan-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115468800 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-chloro-2-N-pentyl-2-N-propan-2-ylbenzene-1,2-diamine |
| SMILES | CCCCCN(c1cc(Cl)ccc1N)C(C)C |
| InChI | InChI=1S/C14H23ClN2/c1-4-5-6-9-17(11(2)3)14-10-12(15)7-8-13(14)16/h7-8,10-11H,4-6,9,16H2,1-3H3 |
| InChIKey | DQSNJAXBZBVMKI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|