About 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine
5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine (PubChem CID 63402856) has the molecular formula C17H25N3
and a molecular weight of 271.41 g/mol. Its IUPAC name is 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine.
Molecular Properties
| Compound Name | 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine |
| PubChem CID | 63402856 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine |
| SMILES | CCCCCN(c1ccc(N)c2ncccc12)C(C)C |
| InChI | InChI=1S/C17H25N3/c1-4-5-6-12-20(13(2)3)16-10-9-15(18)17-14(16)8-7-11-19-17/h7-11,13H,4-6,12,18H2,1-3H3 |
| InChIKey | CXGALUMXZVAMIQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine?
The IUPAC name of 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine (CID 63402856) is 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine.
What is the SMILES notation for 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine?
The canonical SMILES for 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine is CCCCCN(c1ccc(N)c2ncccc12)C(C)C.
What is the InChIKey of 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine?
The InChIKey is CXGALUMXZVAMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3/c1-4-5-6-12-20(13(2)3)16-10-9-15(18)17-14(16)8-7-11-19-17/h7-11,13H,4-6,12,18H2,1-3H3.
What are the key properties of 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine?
5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine has a molecular weight of 271.41 g/mol, XLogP of 4.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-pentyl-5-N-propan-2-ylquinoline-5,8-diamine is sourced from PubChem (CID 63402856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).