C15H23ClN2S — CID 63519079
3-chloro-4-[pentyl(propan-2-yl)amino]benzenecarbothioamide (PubChem CID 63519079) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 3-chloro-4-[pentyl(propan-2-yl)amino]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[pentyl(propan-2-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 63519079 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-chloro-4-[pentyl(propan-2-yl)amino]benzenecarbothioamide |
| SMILES | CCCCCN(c1ccc(C(N)=S)cc1Cl)C(C)C |
| InChI | InChI=1S/C15H23ClN2S/c1-4-5-6-9-18(11(2)3)14-8-7-12(15(17)19)10-13(14)16/h7-8,10-11H,4-6,9H2,1-3H3,(H2,17,19) |
| InChIKey | WQWGFAMFCUSQQA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|