C13H19BrClNO — CID 107084775
2-(bromomethyl)-4-chloro-N-methyl-N-(2-propan-2-yloxyethyl)aniline (PubChem CID 107084775) has the molecular formula C13H19BrClNO and a molecular weight of 320.66 g/mol. Its IUPAC name is 2-(bromomethyl)-4-chloro-N-methyl-N-(2-propan-2-yloxyethyl)aniline.
| Compound Name | 2-(bromomethyl)-4-chloro-N-methyl-N-(2-propan-2-yloxyethyl)aniline |
|---|---|
| PubChem CID | 107084775 |
| Molecular Formula | C13H19BrClNO |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-(bromomethyl)-4-chloro-N-methyl-N-(2-propan-2-yloxyethyl)aniline |
| SMILES | CC(C)OCCN(C)c1ccc(Cl)cc1CBr |
| InChI | InChI=1S/C13H19BrClNO/c1-10(2)17-7-6-16(3)13-5-4-12(15)8-11(13)9-14/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | NNLHSQLSZVYHPU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|