C15H24N2O2S — CID 106714503
2,2-dimethyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylhexanoic acid (PubChem CID 106714503) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylhexanoic acid.
| Compound Name | 2,2-dimethyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylhexanoic acid |
|---|---|
| PubChem CID | 106714503 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2,2-dimethyl-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylhexanoic acid |
| SMILES | Cc1nc(SCCCCC(C)(C)C(=O)O)nc(C)c1C |
| InChI | InChI=1S/C15H24N2O2S/c1-10-11(2)16-14(17-12(10)3)20-9-7-6-8-15(4,5)13(18)19/h6-9H2,1-5H3,(H,18,19) |
| InChIKey | HYFLHHZPIJCGAI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|