3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid

C5H5N3O2S — CID 175084859

IUPAC3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid
SMILESCc1nc(=S)c(C(=O)O)n[nH]1
InChIInChI=1S/C5H5N3O2S/c1-2-6-4(11)3(5(9)10)8-7-2/h1H3,(H,9,10)(H,6,7,11)
InChIKeyAAQOIOAKMHEAQZ-UHFFFAOYSA-N
MW171.18 g/mol
LogP0.54
Rot. Bonds1

About 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid

3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid (PubChem CID 175084859) has the molecular formula C5H5N3O2S and a molecular weight of 171.18 g/mol. Its IUPAC name is 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid.

Molecular Properties

Compound Name3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid
PubChem CID175084859
Molecular FormulaC5H5N3O2S
Molecular Weight171.18 g/mol
Exact Mass171.01
IUPAC Name3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid
SMILESCc1nc(=S)c(C(=O)O)n[nH]1
InChIInChI=1S/C5H5N3O2S/c1-2-6-4(11)3(5(9)10)8-7-2/h1H3,(H,9,10)(H,6,7,11)
InChIKeyAAQOIOAKMHEAQZ-UHFFFAOYSA-N
XLogP0.54
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.18
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid?
The IUPAC name of 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid (CID 175084859) is 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid.
What is the SMILES notation for 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid?
The canonical SMILES for 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid is Cc1nc(=S)c(C(=O)O)n[nH]1.
What is the InChIKey of 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid?
The InChIKey is AAQOIOAKMHEAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2S/c1-2-6-4(11)3(5(9)10)8-7-2/h1H3,(H,9,10)(H,6,7,11).
What are the key properties of 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid?
3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid has a molecular weight of 171.18 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid is sourced from PubChem (CID 175084859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).