C5H5N3O2S — CID 175084859
3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid (PubChem CID 175084859) has the molecular formula C5H5N3O2S and a molecular weight of 171.18 g/mol. Its IUPAC name is 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 175084859 |
| Molecular Formula | C5H5N3O2S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | 3-methyl-5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid |
| SMILES | Cc1nc(=S)c(C(=O)O)n[nH]1 |
| InChI | InChI=1S/C5H5N3O2S/c1-2-6-4(11)3(5(9)10)8-7-2/h1H3,(H,9,10)(H,6,7,11) |
| InChIKey | AAQOIOAKMHEAQZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|