C4H3N3O2S — CID 138571065
5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid (PubChem CID 138571065) has the molecular formula C4H3N3O2S and a molecular weight of 157.15 g/mol. Its IUPAC name is 5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 138571065 |
| Molecular Formula | C4H3N3O2S |
| Molecular Weight | 157.15 g/mol |
| Exact Mass | 156.99 |
| IUPAC Name | 5-sulfanylidene-2H-1,2,4-triazine-6-carboxylic acid |
| SMILES | O=C(O)c1n[nH]cnc1=S |
| InChI | InChI=1S/C4H3N3O2S/c8-4(9)2-3(10)5-1-6-7-2/h1H,(H,8,9)(H,5,6,10) |
| InChIKey | IGVJLAQSIKNVGN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|