C12H16N4O4 — CID 157269829
ethyl 5-methyl-1H-imidazole-4-carboxylate;5-methyl-1H-imidazole-4-carboxylic acid (PubChem CID 157269829) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is ethyl 5-methyl-1H-imidazole-4-carboxylate;5-methyl-1H-imidazole-4-carboxylic acid.
| Compound Name | ethyl 5-methyl-1H-imidazole-4-carboxylate;5-methyl-1H-imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 157269829 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | ethyl 5-methyl-1H-imidazole-4-carboxylate;5-methyl-1H-imidazole-4-carboxylic acid |
| SMILES | CCOC(=O)c1nc[nH]c1C.Cc1[nH]cnc1C(=O)O |
| InChI | InChI=1S/C7H10N2O2.C5H6N2O2/c1-3-11-7(10)6-5(2)8-4-9-6;1-3-4(5(8)9)7-2-6-3/h4H,3H2,1-2H3,(H,8,9);2H,1H3,(H,6,7)(H,8,9) |
| InChIKey | AYKGDHCXKDLPFN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |