C14H15N3O3 — CID 847566
ethyl 4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carboxylate (PubChem CID 847566) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is ethyl 4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 847566 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | ethyl 4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]cnc1C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C14H15N3O3/c1-3-20-14(19)12-11(15-8-16-12)13(18)17-10-6-4-9(2)5-7-10/h4-8H,3H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | YLZFLAXCYHWLKH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |