C18H22N4O4 — CID 16746593
tert-butyl 2-[[4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carbonyl]amino]acetate (PubChem CID 16746593) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is tert-butyl 2-[[4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-[[4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 16746593 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | tert-butyl 2-[[4-[(4-methylphenyl)carbamoyl]-1H-imidazole-5-carbonyl]amino]acetate |
| SMILES | Cc1ccc(NC(=O)c2nc[nH]c2C(=O)NCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-11-5-7-12(8-6-11)22-17(25)15-14(20-10-21-15)16(24)19-9-13(23)26-18(2,3)4/h5-8,10H,9H2,1-4H3,(H,19,24)(H,20,21)(H,22,25) |
| InChIKey | VYIBAPBKYYWBCD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |