C14H17N5O2 — CID 144936571
5-N-ethyl-4-N-[4-(methylamino)phenyl]-1H-imidazole-4,5-dicarboxamide (PubChem CID 144936571) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-N-ethyl-4-N-[4-(methylamino)phenyl]-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 5-N-ethyl-4-N-[4-(methylamino)phenyl]-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 144936571 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 5-N-ethyl-4-N-[4-(methylamino)phenyl]-1H-imidazole-4,5-dicarboxamide |
| SMILES | CCNC(=O)c1[nH]cnc1C(=O)Nc1ccc(NC)cc1 |
| InChI | InChI=1S/C14H17N5O2/c1-3-16-13(20)11-12(18-8-17-11)14(21)19-10-6-4-9(15-2)5-7-10/h4-8,15H,3H2,1-2H3,(H,16,20)(H,17,18)(H,19,21) |
| InChIKey | OXZAPMVHOLQDBU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |