C18H15FN4O2 — CID 4736415
5-N-benzyl-4-N-(4-fluorophenyl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 4736415) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is 5-N-benzyl-4-N-(4-fluorophenyl)-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 5-N-benzyl-4-N-(4-fluorophenyl)-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 4736415 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-N-benzyl-4-N-(4-fluorophenyl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1nc[nH]c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H15FN4O2/c19-13-6-8-14(9-7-13)23-18(25)16-15(21-11-22-16)17(24)20-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,20,24)(H,21,22)(H,23,25) |
| InChIKey | RIJXWUICUIHUCH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |