C19H18N4O3 — CID 4736413
5-N-benzyl-4-N-(3-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide (PubChem CID 4736413) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-N-benzyl-4-N-(3-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide.
| Compound Name | 5-N-benzyl-4-N-(3-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 4736413 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-N-benzyl-4-N-(3-methoxyphenyl)-1H-imidazole-4,5-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2nc[nH]c2C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C19H18N4O3/c1-26-15-9-5-8-14(10-15)23-19(25)17-16(21-12-22-17)18(24)20-11-13-6-3-2-4-7-13/h2-10,12H,11H2,1H3,(H,20,24)(H,21,22)(H,23,25) |
| InChIKey | ZTFNFJHOZKNCPD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |