C8H11N3O2 — CID 158748377
acetonitrile;4,5-dimethyl-1H-pyrazole-3-carboxylic acid (PubChem CID 158748377) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is acetonitrile;4,5-dimethyl-1H-pyrazole-3-carboxylic acid.
| Compound Name | acetonitrile;4,5-dimethyl-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 158748377 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | acetonitrile;4,5-dimethyl-1H-pyrazole-3-carboxylic acid |
| SMILES | CC#N.Cc1[nH]nc(C(=O)O)c1C |
| InChI | InChI=1S/C6H8N2O2.C2H3N/c1-3-4(2)7-8-5(3)6(9)10;1-2-3/h1-2H3,(H,7,8)(H,9,10);1H3 |
| InChIKey | INDULPQPGPVJMS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |