About N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide
N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide (PubChem CID 126996863) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide |
| PubChem CID | 126996863 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide |
| SMILES | CCNC(=O)c1n[nH]c(C)c1C |
| InChI | InChI=1S/C8H13N3O/c1-4-9-8(12)7-5(2)6(3)10-11-7/h4H2,1-3H3,(H,9,12)(H,10,11) |
| InChIKey | IOYGIAYURRHDLN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide?
The IUPAC name of N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide (CID 126996863) is N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide.
What is the SMILES notation for N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide?
The canonical SMILES for N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide is CCNC(=O)c1n[nH]c(C)c1C.
What is the InChIKey of N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide?
The InChIKey is IOYGIAYURRHDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-4-9-8(12)7-5(2)6(3)10-11-7/h4H2,1-3H3,(H,9,12)(H,10,11).
What are the key properties of N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide?
N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide has a molecular weight of 167.21 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 126996863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).