C8H13N3O — CID 126996863
N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide (PubChem CID 126996863) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126996863 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-ethyl-4,5-dimethyl-1H-pyrazole-3-carboxamide |
| SMILES | CCNC(=O)c1n[nH]c(C)c1C |
| InChI | InChI=1S/C8H13N3O/c1-4-9-8(12)7-5(2)6(3)10-11-7/h4H2,1-3H3,(H,9,12)(H,10,11) |
| InChIKey | IOYGIAYURRHDLN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |