C9H15N3O2 — CID 110849199
N-(2-methoxyethyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide (PubChem CID 110849199) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110849199 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(2-methoxyethyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1n[nH]c(C)c1C |
| InChI | InChI=1S/C9H15N3O2/c1-6-7(2)11-12-8(6)9(13)10-4-5-14-3/h4-5H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | JMONWQXNFUMIAG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|