C7H12N4O2 — CID 62082092
4-amino-N-(2-hydroxyethyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 62082092) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-amino-N-(2-hydroxyethyl)-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-(2-hydroxyethyl)-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62082092 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-amino-N-(2-hydroxyethyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCCO)c1N |
| InChI | InChI=1S/C7H12N4O2/c1-4-5(8)6(11-10-4)7(13)9-2-3-12/h12H,2-3,8H2,1H3,(H,9,13)(H,10,11) |
| InChIKey | CCUUDMJLBUSOKJ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |