C12H23N5O — CID 62081384
4-amino-N-[3-(diethylamino)propyl]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 62081384) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-amino-N-[3-(diethylamino)propyl]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-[3-(diethylamino)propyl]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62081384 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 4-amino-N-[3-(diethylamino)propyl]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1n[nH]c(C)c1N |
| InChI | InChI=1S/C12H23N5O/c1-4-17(5-2)8-6-7-14-12(18)11-10(13)9(3)15-16-11/h4-8,13H2,1-3H3,(H,14,18)(H,15,16) |
| InChIKey | NDYJGCABMPVNOS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|