C12H18N6O — CID 62081438
4-amino-N-(4-imidazol-1-ylbutyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 62081438) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is 4-amino-N-(4-imidazol-1-ylbutyl)-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-(4-imidazol-1-ylbutyl)-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62081438 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-amino-N-(4-imidazol-1-ylbutyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCCCCn2ccnc2)c1N |
| InChI | InChI=1S/C12H18N6O/c1-9-10(13)11(17-16-9)12(19)15-4-2-3-6-18-7-5-14-8-18/h5,7-8H,2-4,6,13H2,1H3,(H,15,19)(H,16,17) |
| InChIKey | DMYBEMNTACROBO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|