About 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide
4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 64570786) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide |
| PubChem CID | 64570786 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCC(C)C(C)C)c1N |
| InChI | InChI=1S/C11H20N4O/c1-6(2)7(3)5-13-11(16)10-9(12)8(4)14-15-10/h6-7H,5,12H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | DDVFBBPTXIXFAF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide?
The IUPAC name of 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide (CID 64570786) is 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide?
The canonical SMILES for 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide is Cc1[nH]nc(C(=O)NCC(C)C(C)C)c1N.
What is the InChIKey of 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide?
The InChIKey is DDVFBBPTXIXFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O/c1-6(2)7(3)5-13-11(16)10-9(12)8(4)14-15-10/h6-7H,5,12H2,1-4H3,(H,13,16)(H,14,15).
What are the key properties of 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide?
4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide has a molecular weight of 224.31 g/mol, XLogP of 1.32, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2,3-dimethylbutyl)-5-methyl-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 64570786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).