C12H12BrN3O — CID 110859670
N-(4-bromophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide (PubChem CID 110859670) has the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. Its IUPAC name is N-(4-bromophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110859670 |
| Molecular Formula | C12H12BrN3O |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | N-(4-bromophenyl)-4,5-dimethyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)Nc2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C12H12BrN3O/c1-7-8(2)15-16-11(7)12(17)14-10-5-3-9(13)4-6-10/h3-6H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | HPHKRCMVSCMBRV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |