C11H9BrN2OS — CID 110859671
N-(4-bromophenyl)-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 110859671) has the molecular formula C11H9BrN2OS and a molecular weight of 297.18 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110859671 |
| Molecular Formula | C11H9BrN2OS |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | N-(4-bromophenyl)-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1scnc1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H9BrN2OS/c1-7-10(13-6-16-7)11(15)14-9-4-2-8(12)3-5-9/h2-6H,1H3,(H,14,15) |
| InChIKey | YLIJYFZJAQSFRR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |