C8H12N2OS — CID 110847845
5-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 110847845) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 5-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 5-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110847845 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-methyl-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1scnc1C(=O)NC(C)C |
| InChI | InChI=1S/C8H12N2OS/c1-5(2)10-8(11)7-6(3)12-4-9-7/h4-5H,1-3H3,(H,10,11) |
| InChIKey | IZTLJGGFCIZRNW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |