C7H11N3OS — CID 117214875
5-amino-N-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 117214875) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 5-amino-N-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 5-amino-N-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117214875 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 5-amino-N-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1ncsc1N |
| InChI | InChI=1S/C7H11N3OS/c1-4(2)10-7(11)5-6(8)12-3-9-5/h3-4H,8H2,1-2H3,(H,10,11) |
| InChIKey | OKUJKLSGDIKFEP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |