C10H6Br2N2OS — CID 165118178
2-bromo-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 165118178) has the molecular formula C10H6Br2N2OS and a molecular weight of 362.05 g/mol. Its IUPAC name is 2-bromo-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-bromo-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 165118178 |
| Molecular Formula | C10H6Br2N2OS |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.86 |
| IUPAC Name | 2-bromo-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cnc(Br)s1 |
| InChI | InChI=1S/C10H6Br2N2OS/c11-6-1-3-7(4-2-6)14-9(15)8-5-13-10(12)16-8/h1-5H,(H,14,15) |
| InChIKey | QAQNJYVCRJZTHU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |