C9H5BrClN3OS — CID 80625889
N-(4-bromophenyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80625889) has the molecular formula C9H5BrClN3OS and a molecular weight of 318.58 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80625889 |
| Molecular Formula | C9H5BrClN3OS |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 316.90 |
| IUPAC Name | N-(4-bromophenyl)-5-chloro-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1nnc(Cl)s1 |
| InChI | InChI=1S/C9H5BrClN3OS/c10-5-1-3-6(4-2-5)12-7(15)8-13-14-9(11)16-8/h1-4H,(H,12,15) |
| InChIKey | GJPQEFMSEZKYRQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |