C9H5Cl2N3O2S — CID 107679572
5-chloro-N-(3-chloro-4-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 107679572) has the molecular formula C9H5Cl2N3O2S and a molecular weight of 290.13 g/mol. Its IUPAC name is 5-chloro-N-(3-chloro-4-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(3-chloro-4-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 107679572 |
| Molecular Formula | C9H5Cl2N3O2S |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | 5-chloro-N-(3-chloro-4-hydroxyphenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)c1nnc(Cl)s1 |
| InChI | InChI=1S/C9H5Cl2N3O2S/c10-5-3-4(1-2-6(5)15)12-7(16)8-13-14-9(11)17-8/h1-3,15H,(H,12,16) |
| InChIKey | RWFLBRXKDVZBEH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|