C17H12BrN3O2S — CID 123152203
2-benzamido-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 123152203) has the molecular formula C17H12BrN3O2S and a molecular weight of 402.27 g/mol. Its IUPAC name is 2-benzamido-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzamido-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 123152203 |
| Molecular Formula | C17H12BrN3O2S |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 2-benzamido-N-(4-bromophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ncc(C(=O)Nc2ccc(Br)cc2)s1)c1ccccc1 |
| InChI | InChI=1S/C17H12BrN3O2S/c18-12-6-8-13(9-7-12)20-16(23)14-10-19-17(24-14)21-15(22)11-4-2-1-3-5-11/h1-10H,(H,20,23)(H,19,21,22) |
| InChIKey | LICVURGANMAAQF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |