C7H7N3OS — CID 131999966
4,5-dimethyl-1H-pyrazole-3-carbonyl isothiocyanate (PubChem CID 131999966) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 4,5-dimethyl-1H-pyrazole-3-carbonyl isothiocyanate.
| Compound Name | 4,5-dimethyl-1H-pyrazole-3-carbonyl isothiocyanate |
|---|---|
| PubChem CID | 131999966 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 4,5-dimethyl-1H-pyrazole-3-carbonyl isothiocyanate |
| SMILES | Cc1[nH]nc(C(=O)N=C=S)c1C |
| InChI | InChI=1S/C7H7N3OS/c1-4-5(2)9-10-6(4)7(11)8-3-12/h1-2H3,(H,9,10) |
| InChIKey | KBURBABFMZGMNN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|