C11H9ClN2O2 — CID 84628619
(E)-3-(5-chloro-4-methyl-1H-benzimidazol-2-yl)prop-2-enoic acid (PubChem CID 84628619) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is (E)-3-(5-chloro-4-methyl-1H-benzimidazol-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(5-chloro-4-methyl-1H-benzimidazol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 84628619 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (E)-3-(5-chloro-4-methyl-1H-benzimidazol-2-yl)prop-2-enoic acid |
| SMILES | Cc1c(Cl)ccc2[nH]c(/C=C/C(=O)O)nc12 |
| InChI | InChI=1S/C11H9ClN2O2/c1-6-7(12)2-3-8-11(6)14-9(13-8)4-5-10(15)16/h2-5H,1H3,(H,13,14)(H,15,16)/b5-4+ |
| InChIKey | IZICYOFXPINROC-SNAWJCMRSA-N |
| XLogP | 2.62 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|