About CID 178007921
CID 178007921 (PubChem CID 178007921) has the molecular formula C7H7B3N2
and a molecular weight of 151.58 g/mol.
Molecular Properties
| Compound Name | CID 178007921 |
| PubChem CID | 178007921 |
| Molecular Formula | C7H7B3N2 |
| Molecular Weight | 151.58 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | — |
| SMILES | [B]c1nnc(C(C)C)c([B])c1[B] |
| InChI | InChI=1S/C7H7B3N2/c1-3(2)6-4(8)5(9)7(10)12-11-6/h3H,1-2H3 |
| InChIKey | PEOVIJNHAIVBGU-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.58 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178007921 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178007921?
The IUPAC name of CID 178007921 (CID 178007921) is not available.
What is the SMILES notation for CID 178007921?
The canonical SMILES for CID 178007921 is [B]c1nnc(C(C)C)c([B])c1[B].
What is the InChIKey of CID 178007921?
The InChIKey is PEOVIJNHAIVBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7B3N2/c1-3(2)6-4(8)5(9)7(10)12-11-6/h3H,1-2H3.
What are the key properties of CID 178007921?
CID 178007921 has a molecular weight of 151.58 g/mol, XLogP of -2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178007921 is sourced from PubChem (CID 178007921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).