C12H18N2O — CID 58531206
1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine (PubChem CID 58531206) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine.
| Compound Name | 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine |
|---|---|
| PubChem CID | 58531206 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine |
| SMILES | CC(C)c1nnc(C(C)C)c2c1COC2 |
| InChI | InChI=1S/C12H18N2O/c1-7(2)11-9-5-15-6-10(9)12(8(3)4)14-13-11/h7-8H,5-6H2,1-4H3 |
| InChIKey | GGOIMHYCSZXAJC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |