About 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine
1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine (PubChem CID 58531206) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine |
| PubChem CID | 58531206 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine |
| SMILES | CC(C)c1nnc(C(C)C)c2c1COC2 |
| InChI | InChI=1S/C12H18N2O/c1-7(2)11-9-5-15-6-10(9)12(8(3)4)14-13-11/h7-8H,5-6H2,1-4H3 |
| InChIKey | GGOIMHYCSZXAJC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine?
The IUPAC name of 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine (CID 58531206) is 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine.
What is the SMILES notation for 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine?
The canonical SMILES for 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine is CC(C)c1nnc(C(C)C)c2c1COC2.
What is the InChIKey of 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine?
The InChIKey is GGOIMHYCSZXAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-7(2)11-9-5-15-6-10(9)12(8(3)4)14-13-11/h7-8H,5-6H2,1-4H3.
What are the key properties of 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine?
1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine has a molecular weight of 206.29 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-di(propan-2-yl)-5,7-dihydrofuro[3,4-d]pyridazine is sourced from PubChem (CID 58531206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).