About 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane
3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane (PubChem CID 157399663) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane.
Molecular Properties
| Compound Name | 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane |
| PubChem CID | 157399663 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane |
| SMILES | C.CC(C)c1nsnc1C(C)C |
| InChI | InChI=1S/C8H14N2S.CH4/c1-5(2)7-8(6(3)4)10-11-9-7;/h5-6H,1-4H3;1H4 |
| InChIKey | BMZNDVPCWPUORX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane?
The IUPAC name of 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane (CID 157399663) is 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane.
What is the SMILES notation for 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane?
The canonical SMILES for 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane is C.CC(C)c1nsnc1C(C)C.
What is the InChIKey of 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane?
The InChIKey is BMZNDVPCWPUORX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S.CH4/c1-5(2)7-8(6(3)4)10-11-9-7;/h5-6H,1-4H3;1H4.
What are the key properties of 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane?
3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane has a molecular weight of 186.32 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane is sourced from PubChem (CID 157399663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).