C9H18N2S — CID 157399663
3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane (PubChem CID 157399663) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane.
| Compound Name | 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane |
|---|---|
| PubChem CID | 157399663 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3,4-di(propan-2-yl)-1,2,5-thiadiazole;methane |
| SMILES | C.CC(C)c1nsnc1C(C)C |
| InChI | InChI=1S/C8H14N2S.CH4/c1-5(2)7-8(6(3)4)10-11-9-7;/h5-6H,1-4H3;1H4 |
| InChIKey | BMZNDVPCWPUORX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |