C6H8FNS — CID 138494786
5-fluoro-4-propan-2-yl-1,3-thiazole (PubChem CID 138494786) has the molecular formula C6H8FNS and a molecular weight of 145.20 g/mol. Its IUPAC name is 5-fluoro-4-propan-2-yl-1,3-thiazole.
| Compound Name | 5-fluoro-4-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 138494786 |
| Molecular Formula | C6H8FNS |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 5-fluoro-4-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1ncsc1F |
| InChI | InChI=1S/C6H8FNS/c1-4(2)5-6(7)9-3-8-5/h3-4H,1-2H3 |
| InChIKey | BYPATIOCHYGVPB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |