C9H18N2S — CID 177044611
ethane;3-ethyl-4-propan-2-yl-1,2,5-thiadiazole (PubChem CID 177044611) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is ethane;3-ethyl-4-propan-2-yl-1,2,5-thiadiazole.
| Compound Name | ethane;3-ethyl-4-propan-2-yl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 177044611 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | ethane;3-ethyl-4-propan-2-yl-1,2,5-thiadiazole |
| SMILES | CC.CCc1nsnc1C(C)C |
| InChI | InChI=1S/C7H12N2S.C2H6/c1-4-6-7(5(2)3)9-10-8-6;1-2/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | KDBKGETZAVGHSA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |