C10H17NS — CID 167407500
3,4-diethyl-5-propan-2-yl-1,2-thiazole (PubChem CID 167407500) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 3,4-diethyl-5-propan-2-yl-1,2-thiazole.
| Compound Name | 3,4-diethyl-5-propan-2-yl-1,2-thiazole |
|---|---|
| PubChem CID | 167407500 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3,4-diethyl-5-propan-2-yl-1,2-thiazole |
| SMILES | CCc1nsc(C(C)C)c1CC |
| InChI | InChI=1S/C10H17NS/c1-5-8-9(6-2)11-12-10(8)7(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | KYPMPZFPUXBKTJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |