C16H24S2 — CID 176857673
3,6-diethyl-2,5-di(propan-2-yl)thieno[3,2-b]thiophene (PubChem CID 176857673) has the molecular formula C16H24S2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 3,6-diethyl-2,5-di(propan-2-yl)thieno[3,2-b]thiophene.
| Compound Name | 3,6-diethyl-2,5-di(propan-2-yl)thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 176857673 |
| Molecular Formula | C16H24S2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3,6-diethyl-2,5-di(propan-2-yl)thieno[3,2-b]thiophene |
| SMILES | CCc1c(C(C)C)sc2c(CC)c(C(C)C)sc12 |
| InChI | InChI=1S/C16H24S2/c1-7-11-13(9(3)4)17-16-12(8-2)14(10(5)6)18-15(11)16/h9-10H,7-8H2,1-6H3 |
| InChIKey | RPZGXVYNRQYBNA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |