C15H27N — CID 166458956
3-ethyl-2,4,5-tri(propan-2-yl)-1H-pyrrole (PubChem CID 166458956) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 3-ethyl-2,4,5-tri(propan-2-yl)-1H-pyrrole.
| Compound Name | 3-ethyl-2,4,5-tri(propan-2-yl)-1H-pyrrole |
|---|---|
| PubChem CID | 166458956 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 3-ethyl-2,4,5-tri(propan-2-yl)-1H-pyrrole |
| SMILES | CCc1c(C(C)C)[nH]c(C(C)C)c1C(C)C |
| InChI | InChI=1S/C15H27N/c1-8-12-13(9(2)3)15(11(6)7)16-14(12)10(4)5/h9-11,16H,8H2,1-7H3 |
| InChIKey | JSTDNSZXVXASNV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |