sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol

C13H19ClNaO+ — CID 18362565

IUPACsodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol
SMILESCCc1c(C)c(Cl)c(O)c(C(C)C)c1C.[Na+]
InChIInChI=1S/C13H19ClO.Na/c1-6-10-8(4)11(7(2)3)13(15)12(14)9(10)5;/h7,15H,6H2,1-5H3;/q;+1
InChIKeyUDMMZGGHHKWFHT-UHFFFAOYSA-N
MW249.74 g/mol
LogP1.35
Rot. Bonds2

About sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol

sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol (PubChem CID 18362565) has the molecular formula C13H19ClNaO+ and a molecular weight of 249.74 g/mol. Its IUPAC name is sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol.

Molecular Properties

Compound Namesodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol
PubChem CID18362565
Molecular FormulaC13H19ClNaO+
Molecular Weight249.74 g/mol
Exact Mass249.10
IUPAC Namesodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol
SMILESCCc1c(C)c(Cl)c(O)c(C(C)C)c1C.[Na+]
InChIInChI=1S/C13H19ClO.Na/c1-6-10-8(4)11(7(2)3)13(15)12(14)9(10)5;/h7,15H,6H2,1-5H3;/q;+1
InChIKeyUDMMZGGHHKWFHT-UHFFFAOYSA-N
XLogP1.35
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.74
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol?
The IUPAC name of sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol (CID 18362565) is sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol.
What is the SMILES notation for sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol?
The canonical SMILES for sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol is CCc1c(C)c(Cl)c(O)c(C(C)C)c1C.[Na+].
What is the InChIKey of sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol?
The InChIKey is UDMMZGGHHKWFHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO.Na/c1-6-10-8(4)11(7(2)3)13(15)12(14)9(10)5;/h7,15H,6H2,1-5H3;/q;+1.
What are the key properties of sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol?
sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol has a molecular weight of 249.74 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol is sourced from PubChem (CID 18362565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).