C13H19ClNaO+ — CID 18362565
sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol (PubChem CID 18362565) has the molecular formula C13H19ClNaO+ and a molecular weight of 249.74 g/mol. Its IUPAC name is sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol.
| Compound Name | sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 18362565 |
| Molecular Formula | C13H19ClNaO+ |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | sodium 2-chloro-4-ethyl-3,5-dimethyl-6-propan-2-ylphenol |
| SMILES | CCc1c(C)c(Cl)c(O)c(C(C)C)c1C.[Na+] |
| InChI | InChI=1S/C13H19ClO.Na/c1-6-10-8(4)11(7(2)3)13(15)12(14)9(10)5;/h7,15H,6H2,1-5H3;/q;+1 |
| InChIKey | UDMMZGGHHKWFHT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |