C10H14O3 — CID 130033537
3-ethyl-5,6-dimethylbenzene-1,2,4-triol (PubChem CID 130033537) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethylbenzene-1,2,4-triol.
| Compound Name | 3-ethyl-5,6-dimethylbenzene-1,2,4-triol |
|---|---|
| PubChem CID | 130033537 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-ethyl-5,6-dimethylbenzene-1,2,4-triol |
| SMILES | CCc1c(O)c(C)c(C)c(O)c1O |
| InChI | InChI=1S/C10H14O3/c1-4-7-8(11)5(2)6(3)9(12)10(7)13/h11-13H,4H2,1-3H3 |
| InChIKey | AUYRYYPQTYIPGS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|